Skip navigation

Chemical peisleyite

Name peisleyite
Equivalent Term Na3Al16(SO4)2(PO4)10(OH)17.20H2O
Curation Status No associations have been curated for this chemical yet.
MeSH® ID C500444
External Links

Top ↑ Ancestors

1. ChemicalsInorganic Chemicals Has associated genes Has associated diseases Has associated exposure references Acids Has associated genes Has associated diseases Has associated exposure references Acids, Noncarboxylic Has associated genes Has associated diseases Has associated exposure references Phosphorus Acids Has associated genes Has associated diseases Has associated exposure references Phosphoric Acids Has associated genes Has associated diseases Has associated exposure references Phosphates Has associated genes Has associated diseases Has associated exposure references peisleyite
2. ChemicalsInorganic Chemicals Has associated genes Has associated diseases Has associated exposure references Alkalies Has associated genes Has associated diseases Hydroxides Has associated genes Has associated diseases peisleyite
3. ChemicalsInorganic Chemicals Has associated genes Has associated diseases Has associated exposure references Electrolytes Has associated genes Has associated diseases Has associated exposure references Ions Has associated genes Has associated diseases Has associated exposure references Anions Has associated genes Has associated diseases Has associated exposure references Hydroxides Has associated genes Has associated diseases peisleyite
4. ChemicalsInorganic Chemicals Has associated genes Has associated diseases Has associated exposure references Electrolytes Has associated genes Has associated diseases Has associated exposure references Ions Has associated genes Has associated diseases Has associated exposure references Anions Has associated genes Has associated diseases Has associated exposure references Phosphates Has associated genes Has associated diseases Has associated exposure references peisleyite
5. ChemicalsInorganic Chemicals Has associated genes Has associated diseases Has associated exposure references Phosphorus Compounds Has associated genes Has associated diseases Has associated exposure references Phosphorus Acids Has associated genes Has associated diseases Has associated exposure references Phosphoric Acids Has associated genes Has associated diseases Has associated exposure references Phosphates Has associated genes Has associated diseases Has associated exposure references peisleyite

Top ↑ Descendants

None.