Skip navigation

Chemical pyroglutamyl-(2-propyl)histidyl-prolinamide

Name pyroglutamyl-(2-propyl)histidyl-prolinamide
Equivalent Terms NP 647 | NP-647 | NP647 cpd | pGlu-(2-propyl)His-ProNH2
Curation Status No associations have been curated for this chemical yet.
MeSH® ID C539979
External Links

Top ↑ Ancestors

1. ChemicalsHormones, Hormone Substitutes, and Hormone Antagonists Has associated genes Has associated diseases Has associated exposure references Hormones Has associated genes Has associated diseases Has associated exposure references Peptide Hormones Has associated genes Has associated diseases Has associated exposure references Hypothalamic Hormones Has associated genes Has associated diseases Pituitary Hormone-Releasing Hormones Has associated genes Has associated diseases Thyrotropin-Releasing Hormone Has associated genes Has associated diseases pyroglutamyl-(2-propyl)histidyl-prolinamide
2. ChemicalsAmino Acids, Peptides, and Proteins Has associated genes Has associated diseases Has associated exposure references Peptides Has associated genes Has associated diseases Has associated exposure references Neuropeptides Has associated genes Has associated diseases Hypothalamic Hormones Has associated genes Has associated diseases Pituitary Hormone-Releasing Hormones Has associated genes Has associated diseases Thyrotropin-Releasing Hormone Has associated genes Has associated diseases pyroglutamyl-(2-propyl)histidyl-prolinamide
3. ChemicalsAmino Acids, Peptides, and Proteins Has associated genes Has associated diseases Has associated exposure references Peptides Has associated genes Has associated diseases Has associated exposure references Oligopeptides Has associated genes Has associated diseases Thyrotropin-Releasing Hormone Has associated genes Has associated diseases pyroglutamyl-(2-propyl)histidyl-prolinamide
4. ChemicalsAmino Acids, Peptides, and Proteins Has associated genes Has associated diseases Has associated exposure references Peptides Has associated genes Has associated diseases Has associated exposure references Peptide Hormones Has associated genes Has associated diseases Has associated exposure references Hypothalamic Hormones Has associated genes Has associated diseases Pituitary Hormone-Releasing Hormones Has associated genes Has associated diseases Thyrotropin-Releasing Hormone Has associated genes Has associated diseases pyroglutamyl-(2-propyl)histidyl-prolinamide

Top ↑ Descendants
