Skip navigation

Chemical Organometallic Compounds

Name Organometallic Compounds
Equivalent Terms Compounds, Metalloorganic | Compounds, Metallo-Organic | Compounds, Organometallic | Metalloorganic Compounds | Metallo Organic Compounds | Metallo-Organic Compounds
Definition A class of compounds of the type R-M, where a C atom is joined directly to any other element except H, C, N, O, F, Cl, Br, I, or At. (Grant & Hackh's Chemical Dictionary, 5th ed)
Curator Note For additional curated data about metals, please also see Metals and its chemical descendants.
Top Interacting
Genes
MeSH® ID D009942
External Links

Top ↑ Ancestors

ChemicalsOrganic Chemicals Has associated genes Has associated diseases Has associated exposure references Organometallic Compounds Has associated genes Has associated diseases Has associated exposure references

Top ↑ Descendants

Organometallic Compounds Has associated genes Has associated diseases Has associated exposure references
  (1,10-phenanthroline)(2-phthalic acid)lanthanum(III)
  (1,10-phenanthroline)(9,10-phenanthrenequinonediimine)rhodamine(III)
  (1,10-phenanthroline)bis(sparfloxacinato)nickel(II)
  1,10-phenanthroline-glycine palladium(II)
  1,10-phenanthroline-valine palladium(II)
  1,10-phenanthroline-vanadyl complex
  111In-(1,4,7,10-tetraazacyclododecane-1,4,7,10-tetraacetic acid (DOTA(0)),1-Nal(3),Thr(8))octreotide
  (111)indium-alpha-MSH (3-10), DOTA-beta-Ala(3)-Nle(4)-Asp(5)-Phe(7)-Lys(10)-
  (111)indium-DTPA-PEG-annexin V
  111In-DOTA-1-Nal(3)-octreotide
  111In-DOTA-cyclo(arginyl-glycyl-aspartyl-phenylalanyl-lysyl)
  111In-((DOTA)Ser1,Leu8,Trp22,Tyr25)SS28
  111In-DOTA-Z(HER2-342-pep2)
  (111In-DTPA)n-trastuzumab-(IRDye800)m
  111In-DTPA-trastuzumab
  111In-octreotate, DOTA(0)-Tyr(3)-Thr(8)-
  111In-tetraazacyclododecane-N,N',N'',N'''-tetraacetic acid-Phe(4-NO2)-cyclo(Cys-Tyr-Trp-Lys-Thr-Cys)-Tyr-NH2
  ((1,12-bis(2-hydroxy-3-methoxy-5-(quinolin-3-yl)-benzyl)-1,5,8,12-tetraazadodecane)-gallium(III))+
  11beta,17alpha,21-trihydroxypregn-4-ene-20-one-3-(O-(N-propargyl)carbamoylmethyl)oxime hexacarbonyldicobalt
  (1,1-cyclobutanedicarboxylato)(2,2'-bipyridine)palladium(II)
  1,1-cyclobutanedicarboxylatobis(2-phenylazopyridine)ruthenium(II)
  1,1'-dicarboxycobaltocene
  1,1'-((ethane-1,2-diyldioxy)di-o-phenylene)bis(indoline-2,3-dione)Ag(II)
  1,1'-ethynebenzene-3,3',5,5'-tetracarboxylate-Zinc(II)
  ((1,2,3,3a,7a-eta)-4,5,6,7-tetrahydro-4,7-methanoindenido)(N,N,N',N'-tetramethylethylenediamine)lithium
  1,2,4,5-Tetra((5)trovacenyl)benzene vanadium
  (((1,2-5,6-di-O,O-isopropylideneglucofuranos-3-yl)oxocarbonyl)methyl)cobalt tricarbonyl triphenylphosphine
  (1-(2-(5-(N,N-dimethylamino)naphthalenesulfonamido)ethyl)-1,4,7,10-tetraazacyclododecane)zinc(II)
  1,2-bis(2-(1,3-dithiobismolane)thio)ethane
  (1,2-bis(5-(trimethylaminomethyl)salicylidenamino)ethane)nickel(II)
  1,2-bis(ethoxycarbonyl)ethyl(pyridine)bis(dimethylglyoximato)cobalt(III)
  (12-cyano-12,13-dihydro-11H-cyclopentadipyrido(b-3,2-h, 2',3'-j)phenazine-12-carboxylic acid methyl ester)bis(1,10-phenanthroline)ruthenium(II)
  (1,2-di(cyclopentadienyl)-1,2-di(3-dimethoxyphenyl)ethanediyl)titanium dichloride
  (1,2-di(cyclopentadienyl)-1,2-di(4-N,N-dimethylaminophenyl)ethanediyl)titanium dichloride
  1,2-dilithiobenzene
  1-((2-di-p-tolylbismuthanophenyl)diazenyl)pyrrolidine
  (1,2-propanediamine-N,N,N',N'-tetraacetato)samarium(III)
  1,3,5,8,10,12-hexaaza-2,4,9,11-tetraoxo-6,7-diphenyldodecanato(4-)cobaltate(III)
  (1,3,5-triaminocyclohexane)copper(II)
  1,3,6,8,10,13,16,19-octaazabicyclo-6,6,6-eicosanecobalt(II)
  (1,3,7,9-tetramethylxanthine-8-ylidene)silver acetate
  (1,3-bis(diphenylphosphino)propane)trichlorooxorhenium(V)
  1,3-dibenzyl-4,5-diphenyl-imidazol-2-ylidene silver(I) acetate
  (1,3-dimethylimidazolidine-2-selone-kappaSe)bis(1,10-phenanthroline-kappa2N,N')copper(II) bis(perchlorate)
  1-((3-(N,N-bis(6-(2,2'-bipyridyl-1,1'-dioxide)methyl)carbamoyl)propamoyl)aminomethyl)-3,5-bis(aminomethyl)-2,4,6-triethylbenzene bis(acetic acid) europium(III) trisacetate
  (1,4,7,10-tetra(2-chloroethyl)-1,4,7,10-tetraazacyclododecane)copper(II)
  1,4,7,10-tetraazacyclododecane 1,4,7,10-tetraacetic acid (Cys(3,4,10),D-Phe(7))alpha-MSH(3-13)
  1,4,7,10-tetraazacyclododecane 1,4,7,10-tetraacetic acid (ReO-acetyl(Cys(3,4,10),Phe(7),Arg(7))alpha-MSH(3-13))
  1,4,7,10-tetraazacyclododecane-1,4,7-trisacetic acid-10-maleimidoethylacetamide-europium
  1,4,7,10-tetrakis(2,2'-bipyridyl-5-ylmethyl-bis(2,2'-bipyridine)ruthenium(II))-1,4,7,10-tetraazacyclododecane
  (1,4,7,10-tetrakis((N-(1H-imidazol-2-yl)carbamoyl)methyl)-1,4,7,10-tetraazacyclododecane)thulium(III)
  (1,4,7-tribenzyl-1,4,7-triazacyclononane-N,N',N'')(methylcyano)copper chlorate
  (1,4,7-triisopropyl-1,4,7-triazacyclonanane-N,N',N'')(methylcyano)copper trifluoromethylsulfonate
  (1,4,7-trithiacyclononane)cadmium(II)
  1,4,8,11,15,18,22,25-octabutoxyphthalocyaninato-nickel(II)
  (1,4,8,11-tetraazacyclotetradecane)nickel(ii) perchlorate
  1,4,8,12-tetraazacyclotetradecane osmium(III) chloride
  (1,4-bis(3-pyridyl)-2,3-diazo-1,3-butadiene)dichlorozinc(II) polymer
  (1-(4-toluenesulfonyl)cytosine)zinc(II)
  (1,5,9,13-tetrathiacyclohexadecane-3,11-diol)iridium(III) astatide
  (1,5,9,13-tetrathiacyclohexadecane-3,11-diol)rhodium(III) astatide
  1,5,9-triazacyclododecane (12(ane)N3) Zn(II)
  (1,5-cyclooctadiene)bis((2,5-dimethylphospholano)ethane)rhodium(I)
  1,6,7,12,13,18-hexaazatrinaphthylene titanium
  170Tm-ethylenediamine-tetramethylenephosphonic acid
  177Lu-1,4,7,10-tetraazacyclododecane-1,4,7,10-tetrakis(methylenephosphonic acid)
  177Lu-CHX-A''-DTPA-ABD-(Z(HER2-342))2
  177Lu-DKFZ-617
  177Lu-DOTA-rituximab
  ((177)Lu)Lu-1,4,7,10-tetraazacyclododecane-1,4,7,10-tetra(methane-phosphonic acid)
  (177Lu)Lu(III)1,4,7,10-tetraazacyclododecane-1,4,7,10-tetra(methane-phosphonic acid)
  (177lutetium-DOTA(O)Tyr3)octreotate
  17-propynylestra-1,3,4(10)-triene-3,17-diol dicobalt hexacarbonyl
  17-propynylestra-1,3,5-triene-3,17-diol dicyclopentadienyl dimolybdenum tetracarbonyl
  1,8,15,22-tetraaminophthalocyanatonickel(II)
  188Re 2,2,9,9-tetramethyl-4,7-diaza-1,10-decanedithiol
  188Re 4-hexadecy-2,2,9,9-tetramethyl-4,7-diaza-1,10-decanedithiol
  188Re-4-hexadecyl-1,2,9,9-tetramethyl-4,7-diaza-1,10-decanethiol lipiodol conjugate
  (188)Re-lipiodol
  188Re-MAG3-depreotide
  188Re-N,N-bis(2-mercaptoethyl)-N',N'-diethylethylenediamine
  188Re-SOCTA-trastuzumab
  (1,8-di-(2-imidazolyl)-2,7-diazaoctadiene-1,7)-(N,N',N'',N''')-copper(II)
  1,8-di-(2-imidazoyl)-2,7-diazoctadiene-1,7-(N,N',N'',N''')-Cu(II)diperchlorate
  1,8-dihydroxyethyl-1,3,6,8,10,13-hexaazacyclotetradecanecopper(II)
  (1-benzylimidazole)(N,N-bis(2-aminoethyl)-1,2-ethanediamine)copper(II) diperchlorate
  1-butyltellurenyl-2-methylthioheptene
  (1H-benzotriazol-1-yloxy)-N,N-dimethylmethaniminium hexachloroantimonate
  1-hydroxyethyl-1,4,7-triazacyclononane (9(ane)N3OH) Zn(II)
  1-methoxyallenyllithium
  (1-methylene-(4-nitrophenol)-1,4,7,10-tetraazacyclododecane-4,7,10-triacetamide)gadolinium(III)
  (1-methylene-(4-nitrophenol)-1,4,7,10-tetraazacyclododecane-4,7,10-triacetate)gadolinium(III)
  1-methylthymine osmium tetraoxide bispyridine ester
  1-neopentyl-1,3-benzazaphosphole CuCl
  1-((N,N'((tert-butyloxy)carbonyl)hydrazino))-1,2-dicarba-closo-dodecaborane
  1-O-(4-(1-(4-benzoylphenyl)-3-(3-hydroxy-3-(4-tributylstannylphenyl)propyl)-2-oxo-4-azetidinyl)phenyl)glucuronic acid
  1-oxa-4,7,10-triazacyclododecane (12(ane)N3O) Zn(II)
  (1-oxa-4,7,10-triazacyclododecane)cobalt(III)
  1-oxovanadatrane
  ((1-phenyl-2,5-di-(2-pyridyl)phosphole)gold(I)) chloride
  1-phenyl-2-carbamoylethylgermanium sesquioxide
  1-phenyl-2-carbamoylethyl-germanium sesquisulfide
  211At-labeled monoclonal antibody MX35
  (2,12-dimethyl-3,7,11,17-tetraazabicyclo(11.3.1)heptadeca-1(17),2,6,11,13,15-hexaenato)nickel(II)
  (213)Bi-DTPA-F3
  2,2'-(1,4-butandiyle bis(nitrilo propylidine))bis-1-naphtholato copper(II)
  ((2,2',2'',2'''-(4'-)(((4,6-dichloro-1,3,5-triazin-2-yl)amino)biphenyl-4-yl)-2,2':6',2''-terpyridine-6,6''-diyl)bis-(methylenenitrilo))tetrakis(acetato)europium(III)
  2,2',2'',2'''-((4'-(aminobiphenyl-4-yl)-2,2':6',2''-terpyridine- 6,6''-diyl)bis(methylenenitrilo))tetrakis(acetato) europium(III)
  (2,2'-((2-methyl-2-nitropropane-1,3-diyl)diimino)diacetato)copper(II)
  2,2,2-tricarbonyl-1,1-bis(ethylene)-mu-(eta(5),eta(5)-fulvalene)-2-methylrhodiumtungsten
  (2-(2-(4-nitrophenyl)hydrazono)-1-phenyl-2-(2-quinolyl)-1-ethanone)copper(II)
  (225)actinium-1,4,7,10-tetraazacyclododecane-N,N',N'',N'''-1,4,7,10-tetra(methylene)phosphonic acid
  2,2':6',2''-terpyridine-2,3-bis(2-pyridyl)pyrazine-PF6(RuCl)
  (2,2':6',2' '-terpyridine-4,4',4' '-tricarboxylate)ruthenium(II) tris(tetrabutylammonium) tris(isothiocyanate)
  (2-((2,6-diisopropylphenyl)amido)-4-((2,6-diisopropylphenyl)imino)-2-pentene)isopropylzinc
  227Th-ethylenediamine-tetramethylenephosphonic acid
  (227)thorium-1,4,7,10-tetraazacyclododecane-N,N',N'',N'''-1,4,7,10-tetra(methylene)phosphonic acid
  (227)thorium-diethylene triamine N,N',N''-penta(methylene)phosphonic acid
  2,2'-bipyridine-alpha, alpha'-diaminoadipic acid palladium(II)
  2,2'-bipyridine-alpha, alpha-diaminosuberic acid palladium(II)
  (2,2'-bipyridine)bis(4,4'-diheptadecyl-2,2'-bipyridyl)ruthenium(II) chloride
  (2,2'-bipyridine)(diaminosuccinic acid)palladium(II)
  (2,2'-bipyridine)(dipicolinic acid)ruthenium(II)
  (2,2'-bipyridine)(octylglycinato)palladium(II) nitrate
  2,2'-bipyridin n-butyl dithiocarbamato Pd(II) nitrate
  2,2'-bipyridyl-6-carbothioamide copper(II) complex
  (2,2'-bipyridyl-kappa2N,N')bis(salicylato-kappa2O,O')zinc(II)
  (2,2'-bipyridyl)(pentamethylcyclopentadienyl)rhodium
  (2,2'-biquinoline-kappa(2)N,N')dichloroIIcopper(II)
  (2,2'-biquinoline-kappa(2)N,N')dichloropalladium(II)
  (2,2'-biquinoline-kappa(2)N,N')dichlorozinc(II)
  2,2'-bis(1,3,4-triphenyl-4,5-dihydro-1H-1,2,4-triazol-5-ylidene)nickel(0)
  (2-(2-(bis(2-(1H-imidazol-2-ylmethyleneamino)ethyl)amino)ethyliminomethyl)imidazolido)cobalt(III)
  (2,2'-bis((4-hydroxyphenanthren-3-yl)formimino)-1,1'-bisnaphthalene)zinc(II)
  2,2'-bis(diphenylphosphino)-1,1'-binaphthyl-Ru(OAc)2
  2,2'-diamino-3,3',5,5'-tetramethyldiphenyl ditelluride
  2,2'-dimethoxydiphenyl ditelluride
  (2-(2-pyridyl)-1H-benzimidazole-kappa2N2,N3)bis(p-toluato-kappa2O,O')manganese(II)
  2-(3-(1-carboxy-5-(7-(5-carboxy-5-(3-phenyl-2-(3-phenyl-2-(2-(4,7,10-triscarboxymethyl-1,4,7,10-tetraazacyclododec-1-yl)acetylamino)propionylamino)propionylamino)pentylcarbamoyl)heptanoylamino)pentyl)ureido)pentanedioic acid gallium(III)
  (2,3,5,6,8,9,11,12-octahydro-N-(3-(1,4,7,10-tetraazacyclododec-1-yl)propyl)-1,4,7,10,13-benzopentaoxacyclopentadecin-15-amine)copper(II)
  2-(3-(5-(7-(1-benzyloxycarbonyl-5-(2-(4,7,10-triscarboxymethyl-1,4,7,10-tetraazacyclododec-1-yl)acetylamino)pentylcarbamoyl)heptanoylamino)-1-carboxypentyl)ureido)pentanedioic acid gallium(III)
  2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphine cobalt(II)
  ((2,3,7,8,12,13,17,18)-octaethylporphinato)copper (II)
  (2,3,7,8,12,13,17,18--octaethylporphinato)perchloratomanganese(III)
  (2,3-bis(5-(trimethylaminomethyl)salicylidenamino)butane)nickel(II)
  2,3-bis(phenyltellanyl)naphthoquinone
  (2,3-butanedione bis(N(4)-dimethylthiosemicarbazone))zinc(II)
  2-(3-stibonophenyl)malonic acid
  2,(3)-tetra-((3,5-di- tert-butyl)-phenyloxy)-phthalocyaninato indium bromide
  2,(3)-tetra-tertbutyl-phthalocyaninato indium chloride
  (2-(4,5-dihydro-1H-imidazol-2-yl)-1H-benzotriazole)dichlorocopper(II)
  2,4,6-triisopropylbenzenetellurinic acid
  2,4,6-trimethylphenylcalcium iodide
  (2-(4-carboxyphenylazo)-4,5-dimethylphenolato)(ethylenediamine-N,N'-diacetato)cobalt(III)
  2-(4-chlorophenyl)-4-methylchromenium
  2,5-di-(2-(3,5-bis(2-pyridylmethyl)amine-4-hydroxy-phenyl)-ethylene)-pyrazine-Zn
  2,6,11,15-tetraoxa-9,17-diaza-1,7,10,16-(1,2)-tetrabenzenacyclooctadecaphan-8,17-diene-Co(II)
  (2,6-diacetylpyridine bis((2-(hydroxyimino)propanoyl)hydrazone)(2-))nickel(II)
  2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-21H,23H-porphine rhodium complex
  (2,9-bis(4'-hydroxyphenyl)phenanthroline)copper(II)
  (2,9-dihydroxyphthalocyaninato)zinc(II)
  (2,9-dimethyl-1,10-phenanthroline)(thiophenolato)copper(I)
  (2-acetoxy-(2-propynyl)benzoate)exacarbonyldicobalt
  2-aminothiazolium(trans-tetrachlorobis(2-aminothiazole)ruthenate(III))
  2-formylpyridine thiosemicarbazonato copper(II)
  2-hydroxy-1-naphthaldehyde-2-amino-5-phenylthiazole manganese
  2-hydroxyphenyl-azo-2'-naphthol, Co(II) complex
  2-lithio-3,3-dimethyl-2-oxazolinyloxirane
  2-lithiofuran
  2-lithio-N-methylpyrrole
  2-lithiothiophene
  2-mercaptobenzothiazole-(5,10,15,20-tetrakis-(3-methoxy-4-hydroxyphenyl)porphyrinato)copper(II)
  (2-methyl-1-(methyl-(2-pyridin-2-ylethyl)amino)propane-2-thiolate)zinc(II)
  2-methylcyclopentadienyl manganese tricarbonyl Has associated genes Has associated diseases
  2-methylthiosemicarbazide copper(II) nitrate
  (2-(N,N-dimethylamino(methyl)phenyl)-C1,N)(pyridine) palladium(II) triflate
  (2-phenylazo-4-cresolato)(ethylenediamine-N,N'-diacetato)cobalt(III)
  2-phenylethynyl-butyltellurium
  2-propenylgermane
  2-sulfoethylammonium hexafluoridoantimonate
  2-thienyl(cyano)cuprate
  2'-tricarbonylcyclopentadienylrhenium-SCH-23390
  2-vanadio-3-phosphoglycerate
  3-(1,8-naphthalimido)propyl-modified silica gel
  3-(2,8,9-trioxa-5-aza-1-germatricyclo(3.3.3.0)undecane-1-yl)-3-(4-hydroxyl-3-methoxyphenyl)propionic acid
  3-(2,8,9-trioxa-aza-1-germatricyclo(3.3.3.0)undecane-1-yl)caffeic acid
  (3,3'-(2,2'-(ethylenedioxy)dibenzylidene)bis(S-methyl dithiocarbazate))nickel(II)
  3,3'-diaminodiphenyl ditelluride
  3',4',5',6'-tetrachlorogallein-molybdenum(VI) complex
  3-(4-(N,N-dimethylamino)benzenetellurenyl)propanesulfonic acid
  3,6,9,12-tetraazatetradecane-1,14-diylbis(zinc dithiocarbamate)-S,S'-dioxide
  3,6-di-(dimethylamino)-dibenzopyriodonium lanthanum-EDTA
  3,6-di(dimethylamino)dibenzopyriodonium praseodymium dicitrate complex
  (3-amino-1,2,4-triazino(5,6-f)1,10-phenanthroline)bis(1,10-phenanthroline)cobalt(III)
  (3-aminohexahydroazepine)dichloroplatinum(II)
  3-butyl-1-phenyl-2-(phenyltelluro)oct-2-en-1-one
  (3-ethoxy-2-oxobutraldehyde bis(N(4),N(4)-dimethylthiosemicarbazonato))copper(II)
  3-ethoxy-2-oxobutyraldehyde bis(N(4)-dimethylthiosemicarbazonato)cadmium
  3-ethoxy-2-oxobutyraldehyde bis(thiosemicarbazonato)copper(II)
  3-ethyl-3'-methyl-thiatelluracarbocyanine iodide
  3-lithiothiophene-2-carboxylate
  (3-methylorotato)(1,2-diaminocyclohexane)palladium (II)
  3'-tricarbonylcyclopentadienylrhenium-SCH-23390
  3-(trihydroxygermyl)propanoic acid
  3-zinciobenzofuran
  3-zincioindole
  (4,10-bis(carboxymethyl)-1,4,7,10-tetraazabicyclo(5.5.2)tetradecane)copper(II)
  (4'-(10-methyl-9-anthryl)-2,2'-6',2''-terpyridine-6,6''-diyl)bis(methylenenitrilo) tetrakis(acetate)-Eu(3+)
  (4,11-bis(carboxymethyl)-1,4,8,11-tetraazabicyclo(6.6.2)hexadecane)copper(II)
  (4,14-diaza-1,7,10,16-tetrathiacyclooctadecane)cadmium(II)
  (4'-(3-amino-1-propynyl)phenyl-2,2',2''-terpyridine-bis(methylenamine)tetraacetic acid)europium(III)
  4,4',4',4''-tetrasulfophthalocyaninecobaltate(III)
  (4,4'-bipyridine)(2-pyridylsulfonate)copper
  (4,4'-diamino-2,2'-bipyridine)(dipyrido(a-2',3'-c)phenazine)osmium(II)
  (4,4'-diethylaminomethyl-2,2'-bipyridine)bis(2,2'-bipyridine)ruthenium(II)
  4,4'-diisopropyldiphenyl ditelluride
  (4,4-dimethyl-2,2-bipyridine)(acetylacetonate)copper(II) Has associated genes Has associated diseases
  (4'-(4-methacryloyloxymethylphenyl)-2,2'-6',2''-terpyridine)(4'-(4-methoxyphenyl)-2,2'-6',2''-terpyridine)ruthenium(II)
  4'-(4-methylphenyl)-2,2':6',2''-terpyridine-2,3-bis(2-pyridyl)pyrazine-PF6(RuCl)
  (4'-(4-(N-succinimidyloxycarbonyl)phenyl)terpyridine)(terpyridine)ruthernium(II)
  (4',5,7-trihydroxyflavanone benzoyl hydrazone)copper(II)
  (4',5,7-trihydroxyflavanone benzoyl hydrazone)zinc(II)
  (4,5,9,11,14-pentaazabenzo(b)triphenylene)bis(1,10-phenanthroline)ruthenium(II)
  4',5'-bis(1,3,2-dithioarsolan-2-yl)fluorescein Has associated genes Has associated diseases
  4,6-di-tert-butyl-3-((2-hydroxyethyl)thio)benzene-1,2-diol-copper(II)
  4,6-di-tert-butyl-3-((2-hydroxyethyl)thio)benzene-1,2-diol-nickel(II)
  4,6-O-benzylidene-3-O-tert-butyldimethylsilyl-1-tributylstannylglucal
  4-aminiosalicylic acid ethylenediaminetetraacetate terbium(III)
  (4-amino-1,4-dihydro-3-(2-pyridyl)-5-thioxo-1,2,4-triazole)copper(II) Has associated genes Has associated diseases
  4-aminopyridin ammonium tetrachlor palladium
  (4-aminopyridine-kappaN1)(phthalocyaninato-kappa4N)zinc(II)
  4-antimonybenzenesulfonyl fluoride
  (4-bis(4,4,5,5,6,6,6-heptafluoro-1,3-hexanedionyl)benzene)lanthanum(III)
  4-bromo-2,5-bis(hexyloxy)phenylmagnesium
  (4-bromomethyl-4'-methylbipyridine)(bis(bipyridine))ruthenium(II)
  (4-((Carbamimidoylhydrazono)methyl-kappa2N1,N4)-5-hydroxymethyl-2-methylpyridinium-3-olate-kappaO)(methanol-kappaO)copper(II) dinitrate.
  4-(cyclopentadienyltricarbonylmanganio)-2,6-diphenylpyrylium tetrafluoroborate
  4-(cyclopentadienyltricarbonylrhenio)-2,6-diphenylpyrylium tetrafluoroborate
  4-fluorophenylmagnesium bromide
  4-fluorophenylzinc chloride
  4-hydroxy-2,6-dimethylphenyl-2,6-dimethylphenyl telluride
  (4-hydroxy-3-nitrocoumarin)bis(phenanthroline)silver(I)
  (((((4-hydroxy-4,4-diphosphonobutyl)carbamoylmethyl)carbamoylmethyl)carbamoylmethyl)carbamoylmethanethiolate)oxorhenium(V)
  4-methoxy-1-(8-phenylmenthoxycarbonyl)pyridinium hexachloroantimonate
  4-methyl-2-aminopyridine-palladium chloride
  4-methylphenylthallium(III)bis(fluoroacetate)
  (5,10,15,20-tetrakis(2,6-dichlorophenyl)porphinato)cobalt(II)
  (5-(2-formylphenyl)-10,15,20-triphenylporphyrinato)nickel(II)
  (5,6-(4,5-dichlorobenzo)-3,8,11,13-tetraoxo-2,2,9,9-tetramethyl-12,12-diethyl-1,4,7,10-tetraazacyclotridecane)oxochromate(V)
  5,7,12,14-tetramethyldibenzo(b,i)(1,4,8,11)tetraazacyclotetradecahexenate
  (5,9,14,18,23,27,32,36-octabutoxynaphthalocyanine)cobalt(II)
  (5,9,14,18,23,27,32,36-octabutoxynaphthalocyanine)copper(II)
  5-aminosalicylic acid ethylenediaminetetraacetate europium(III)
  5-bromo-4-hexylthiophen-2-ylmagnesium
  5-(bromoacetamido)-1,10-phenanthroline copper complex
  5-lithiothiophene-2-carboxylate
  5-methoxyindolylmagnesium bromide
  5-methyl-2'-deoxycytidine glycol-dioxoosmium-bipyridine
  5-phenylazo-3-methoxysalicylidene thiosemicarbazone copper II
  (6,13-dimethyl-1,4,8,11-tetraazacyclotetradecane-6,13-diamine)cobalt(III)
  61Cu-DOTA-HSA
  (64)Cu-bis-DOTA-hypericin
  64Cu-DOTA-1C1
  64Cu-DOTA-abergrin
  64Cu-DOTA-bombesin(1-14), Pro(1)-Tyr(4)-
  64Cu-DOTA-cetuximab Has associated genes Has associated diseases
  64Cu-DOTA-conatumumab
  64Cu-DOTA-C-type-atrial natriuretic factor
  64Cu-DOTA-NAPamide
  64Cu-DOTA-RGD4C-TNF
  64Cu-DOTA-rituximab
  64Cu-DOTATATE
  64Cu-DOTA-trastuzumab
  64Cu-DOTA-VEGF(DEE)
  (64)Cu-DOTA-vMIP-II
  64Cu(II)-bis(dithiocarbamatebisphosphonate)
  (64)Cu-NO2A-8-Aoc-BBN(7-14)NH(2)
  64Cu-NOTA-ALT-836-Fab
  6-(5-carboxylpentyl)-5,7-dioxo-1,4,8,11-tetraazaundecane 109 Pd(II)
  6,7-dicycanodipyridoquinoxaline manganese(II) complex
  (6,8,15,17-tetramethyldibenzo-5,9,14,18-tetraazacyclotetradecene)nickel(II)
  68Ga-1,4,7,10-tetraazacyclododecane 1,4,7,10-tetraacetic acid (ReO-acetyl(Cys(3,4,10),Phe(7),Arg(7))aplha-MSH(3-13))
  68Ga bombesin(6-14)amide, DOTA-PEG2-Tyr(6)-beta-Ala(11)-Thi(13)-Nle(14)-
  68Ga-DOTA-4-FBn-TN14003
  68Ga-DOTA-cyclo(arginyl-glycyl-aspartyl-phenylalanyl-lysyl)
  68Ga-DOTA-exendin-4
  68Ga-DOTA-hEGF
  68Ga-DOTA-iodo-Tyr(3)-octreotate
  68Ga-DOTANOC
  68Ga-DOTA-octreotide
  68Ga-DOTATATE
  (68Ga)Glu-urea-Lys(Ahx)-HBED-CC
  68Ga-labelled DTPA galactosyl human serum albumin
  68Ga-octreotide, DOTA(0)-Tyr(3)-
  6-methyl-2-aminopyridine palladium dichloride
  6-phenyl-7(6H)-isoselenazolo(4,3-d)pyrimidone
  (7,7'-methylenedioxyphenyl-dipyrido-(3,2-a-2',3'-c)phenazine)bis(1,10-phenanthroline)rithenium(II)
  (7-hydroxy-4-methylcoumarin)cerium(III)
  (8,12-diethyl-2,3,7,13,17,18-hexamethylcorrolato)manganese(III)
  86Y-DOTA-bombesin(1-14), Pro(1)-Tyr(4)-
  (89Zr)oxinate(4)
  8-hydroxyquinoline-Zr(IV)-EDTA
  90Y-MOv18-Bz-DOTA conjugate
  90Y-octreotate, DOTA(0)-Tyr(3)-Thr(8)-
  9-(2'-carboxyphenyl)-4,5-dibromo-2,3,7-trihydroxy-6-fluorone-aluminum (III) complex
  9-anthryltriphenylstibonium
  aceglutamide aluminum
  (acenaphthereno(1,2-b)-1,4,8,9-tetraazariphenylence)bis(1,10-phenanthroline)ruthenium(II)
  (acenaphthereno(1,2-b)-1,4,8,9-tetraazariphenylence)bis(2,2'-bipyridine)ruthenium(II)
  acetatobis((bis(2-benzimidazolylmethyl)amino)ethanol)manganese(III)acetatomanganese(III)
  (acetato-kappa2O,O')dihydroxidoytterbium(III)hemihydrate
  (acetato-kappaO)(ris(3,5-dimethylpyrazol-1-yl-kappaN2)hydroborato)zinc(II)
  acetato(N,N,N',N'-tetrakis(2-pyridylmethyl)-1,3-diamino-2-propanol)dizinc
  acetatotetrakis((3-phenoxyphenyl)porphyrinato)rhenium(III)
  acetylacetonate-1,5-cyclooctadiene iridium I
  acetylacetonate-1,5-cyclooctadiene rhodium I
  (acetylacetonato)dicarbonylrhodium(I)
  acetyl-alanyl-histidyl-alanyl-alanyl-alanyl-histidyl-alaninecarboxamide tetraammineruthenium(III) conjugate
  acetylruthenocene
  acetyltelluronium choline
  Acid Blue 158
  Acid Blue 193
  actinium 1,4,7,10,13,16-hexaazacyclohexadecane-N,N',N'',N''',N'''',N'''''-hexaacetic acid
  adeninylpentylcobalamin
  adenosine diphosphate tetrafluoroaluminate
  Afodial
  (Ag(2-amino-3-methylpyridine)(2))NO(3)
  Ag4Ni2(meso-2,3-dimercaptosuccinic acid)4
  Ag(pyridine-2-carboxaldoxime)NO(3)
  Al2(5,8-di-Br-HB)Cl4
  (Al2(5,8-dibromohypocrellin B)tetrachloride)n
  AL 3823A
  (alanyl-histidyl-lysine)copper(II)
  ALF492
  Al(III)-bis(imino)pyridine
  allyloxymethylmagnesium chloride
  alpha-dimethylaminocyclohexoxyl dimethylgallium
  alpha-tris(2,4-pentanedionato-kappa(2)O,O')aluminum(III)
  alpha-tris(2,4-pentanedionato-kappa2O,O')chromium(III)
  alpha-tris(2,4-pentanedionato-kappa(2)O,O')cobalt(III)
  aluminium glycinate, myrtecaine drug combination
  aluminoxamine
  aluminum adenosine triphosphate
  aluminum chloride phthalocyanine
  aluminum chloride-valine-sodium hydroxide system
  aluminum(III) phthalocyanine trisulfonic acid
  aluminum maltolate Has associated genes Has associated diseases
  aluminum phthalocyanine
  aluminum phthalocyanine disulfonate
  aluminum phthalocyanine-streptavidin complex
  aluminum tetrasulfophthalocyanine
  aluminum tris(2,6-di-2-naphthylphenoxide)
  aluminum tris(2,6-diphenylphenoxide)
  aluminum zirconium tetrachlorohydrexglycerin
  AMD 6221 Has associated genes Has associated diseases
  aminehexa-mu(2)-chlorido-mu(4)-oxido-tris(1,4,6-triazabicyclo(3.3.0)oct-4-ene)tetracopper(II)
  aminoguanidinium pentafluorozirconate
  ammonium citratoperoxotitanate IV
  ammonium hexachlorotellurate
  ammonium oxodiperoxo-1,10-phenanthroline-vanadate
  ammonium oxodiperoxo(2-(2'-pyridyl)imidazole)vanadate(III)
  ammonium oxodiperoxo(5,6-dimethyl-1,10-phenanthroline)vanadate(III)
  ammonium oxotriperoxo-1,10-phenanthroline-vanadate
  anthiolimine
  antimony choline
  antimonyl-2,4-dihydroxy-5-hydroxymethylpyrimidine
  antimonyl-2,4-dihydroxypyrimidine
  antimonyl-2-hydroxy-1,3-dicarboxynaphthalene
  antimonyl-2-hydroxy-3-carboxy-1-sodium acrylate naphthalene
  antimonyl-7-formyl-8-hydroxyquinoline-5-sulphonate
  antimony nitrilotriacetic acid
  Antimony Potassium Tartrate Has associated genes Has associated diseases
View node Antimony Sodium Gluconate Has associated genes Has associated diseases
  antimony sodium tartrate Has associated diseases
  antimonytrithious acid triphenyl ester
  Antral
  aqua(1,10-phenanthroline)(phenylalaninato)copper(II)
  aqua(2,2'-diamino-4,4'-bi-1,3-thiazole-kappa(2)N,N')(oxydiacetato-kappa(3)O,O',O'')cobalt(II)
  aquabis(3-methoxy-2-pyridonato)(2,2':6',2''-terpyridine)ruthenium(II)-acetonitrile
  aquabromo(mu-acetato)(mu-methoxo)(1,5-bis(5-methylsalicylidenamino)pentan-3-ol)dimanganese(III)
  aquachloro(pyridoxal thiosemicarbazone)copper(II) chloride
  aquadiacetate(N-oxymethylurea)zinc hydrate
  aquadichloro(benzimidazole)-copper(II)
  aqua(edetic acid)chromium(III) Has associated genes Has associated diseases
  aqua(glycylalanyl)copper(II)
  aquahydroxo(tris(aminoethyl)amine)chromium(III)
  aqua(n-hexyl)(3,3'-(propane-1,3-diyldinitrilo)bis(butan-2-one)dioximato-kappa(4)N)cobalt(III)
  aqua(N,N'-bis(6-carboxy-2-pyridylmethyl)ethylenediamine-N,N'-methylenephosphonic acid)gadolinate(III)
  aqua(N-salicylidineglycinato)copper(II)
  aqua(oxydiacetato)copper(II)
  aqua(phenanthroline)(tyrosine)copper(II)
  aqua(tri(6-aminopyridin-2-yl)amine)zinc(II)
  aquatricarbonyl(1,10-phenanthroline-N,N')rhenium(I)
  aquatrichloridobis(1,10-phenanthroline)cerium(III)
  aquatrichloro(dimethylsulfoxide)(5,7-(1,2,4)triazolo(1,5-a)pyrimidine)ruthenium(III)
  aqua(tri(pyridin-2-yl)amine)zinc(II)
  aqua(tris(pyrid-2-yl)methoxymethane)(di(pyrazol-1-yl)propane)ruthenium(II)
View node Arsenicals Has associated genes Has associated diseases Has associated exposure references
  arsenotrithious acid triphenyl ester
  As-N-7a
  astemizole tetrachlorocuprate(II)
  atsizol
  avidin-dendrimer-(1B4M-Gd)(254)
  azido(2-(diphenylphosphino)benzaldehyde semicarbazonato-kappa2P,N1,O)nickel(II)
  azido ruthenium
  azidotetrakis(trimethylphosphine)nickel(II)
  B12-(BQBA(Re(CO)3))
  B-22956-1
  bamet H2
  BBM-928 B
  BBR 2382
  benzoyltrimethylgermane
  benzyl bis(thiosemicarbazone)palladium(II)
  benzyl-bis(triphenylphosphine)palladium(II)
  (beta-5'-deoxyadenosyl)(alpha-cyano)cobalamin
  beta-ferrocenylalanine
  beta-ruthenocenylalanine
  bi 4-aminopyridin dichlor palladium
  bidentate tetraaquarhodium adenosine 5'-triphosphate complex
  bilharcid
  binaphthyldiimine Ni(II)
  biotinylcyclopentadienylmanganese tricarbonyl
  biphosphinic palladacycle complex Has associated genes Has associated diseases
  (bipyridine)(2-phenyl(5-fluoro)-imidazo(f)-1,10-phenathroline)ruthenium
  bis(1,10-phenanthroline)(1,10-phenanthrolino(5,6-b)1,4,5,8,9,12-hexaaxatriphenylene)ruthenium(II)
  bis(1,10-phenanthroline)(1-(4-(4-(5,10,15-tetraphenylporphyrin-20-yl)phenoxy)butyl)imidazo(4,5-f)(1,10)phenanthroline)ruthenium(II)
  bis(1,10-phenanthroline)(dipyrido(3,2-alpha-2'.3'-C)phenazine)ruthenium (II)
  bis(1,10-phenanthroline)(dipyrido(3,2-d-2,3-f)quinoxaline)cobalt(III)
  bis(1,10-phenanthroline)rhodium(III)
  bis(1,2-benzisothiazol-3(2H)-one 1,1-dioxido-N:O)bis(1,2-benzisothiazol-3(2H)-one 1,1-dioxido-N)bis(imidazole)copper(II)
  bis(1,2-bis-(diphenylphosphino)ethane)Cu(I)
  bis(1,2-bis(diphenylphosphino)ethane)palladium
  bis-(1,2-bis(diphenylphosphino)ethene)Cu(I)
  bis(1,2-bis(diphenylphosphino)ethylene)dichlororhenium(II) hexane
  bis(1-(2-hydroxyethyl)-4,10-diazapyrazolo(4,3-b)fluoren-5(1H)-one thiosemicarbazonato)zinc(II)
  bis(1,3,4,6,7,8-hexahydropyrimido(1,2-a)pyrimidine) dichloro-di-copper(I)
  bis(1,3,5-benzenetricarboxylate)tricopper(II)
  bis(1,3-di-tert-butylimidazolin-2-iminato) titanium
  bis(1,4,7,10-tetraoxacyclododecane)lithium(1) bis((1,2,3,3a,7a-eta)-4,5,6,7-tetrahydro-4,7-methanoindenido)lithate(1-)
  bis(1,4,7,10-tetrathiacyclododecane)cadmium(II)
  bis(1-hydroxypyridine-2(1H)-thionato-S,O)copper(II)
  bis(1-N-oxide-pyridine-2-thiolato)oxovanadium(IV)
  bis(1-oxy-2-pyridinethiolato)oxovanadium(IV)
  bis(2,(2'-benzothienyl)-pyridinato-N,C3')(acetylacetonate)Ir(III)
  bis(2,2'-bipyridine)(11-aminopteridine(6,7-f)(1,10)phenanthrolin-13(121H)-one)ruthenium(II)
  bis(2,2'-bipyridine)(2-(2-hydroxyphenyl)imidazo(4,5-f)(1,10)phenanthroline))ruthenium(II)
  bis(2,2'-bipyridine)(2-(4-benzoimidazolyl)phenylimidazo(4,5-f)(1,10)phenanthroline)ruthenium(II)
  bis(2,2'-bipyridine)(2-(4-benzothiazolyl)phenylimidazo(4,5-f)(1,10)phenanthroline)ruthenium(II)
  bis(2,2'-bipyridine)(2-(5-phenyl-1H-(1,2,4)triazol-3-yl)pyrazine)ruthenium(II)
  bis(2,2'-bipyridine)(2-(5-phenyl-1H-(1,2,4)triazol-3-yl)pyridine)ruthenium(II)
  bis(2,2'-bipyridine)(4-(3,4-diaminophenoxy)-2,2'-bipyridine)ruthenium(II) hexafluorophosphate
  bis(2,2'-bipyridine)(4,4'-bis(3-aminopropylcarbamoyl)-2,2'-bipyridine)ruthenium(II)
  bis(2,2'-bipyridine)(4,4'-bis(4-aminobutyl)-2,2'-bipyridine) ruthenium perchlorate
  bis(2,2'-bipyridine)(4,4'-bis(4-aminobutyl)-2,2'-bipyridine) ruthenium perchloroate
  bis(2,2'-bipyridine)(4,5,9,11,14-pentaazabenzo(b)triphenylene)ruthenium(II)
  bis(2,2'-bipyridine)-4'-methyl-4-carboxybipyridine-ruthenium-N-succinimidyl ester
  bis(2,2'-bipyridine)(5,6-epoxy-5,6-dihydro-(1,10)phenanthroline)ruthenium
  bis(2,2'-bipyridine)(benzo(a)phenazine-5,6-quinone diimine)rhodium(III)
  bis(2,2'-bipyridine)(benzo(a)phenazine-5,6-quinonedimine)rhodium(III)
  bis(2,2'-bipyridine)bis(2-(1-pyrenyl)-1H-imidazo(4,5-f)(1,10)phenanthroline)ruthenium(II)
  bis(2,2'-bipyridine)(chrysene-5,6-quinonediimine)rhodium(III)
  bis(2,2'-bipyridine)decakis(poly(vinyl pyridine))osmium(II)
  bis(2,2'-bipyridine)decakis(poly(vinyl pyridine))ruthenium(II)
  bis(2,2'-bipyridine)(m-glycine-histidine-lysine)ruthenium(II)
  bis(2,2'-bipyridine)oxovanadium(IV)
  bis(2,2'-bipyridyl-4,4'-dicarboxylate)ruthenium(II) bis(tetrabutylammonium) bis(thiocyanate)
  bis(2,2'-bipyridyl)(dipyrido(3,2-alpha-2',3'-c)phenazine)ruthenium (II)
  bis(2,2'-bipyridyl-kappa2N,N')(imidazolidine-2-thione-kappaS)copper(II) bis(perchlorate)
  bis(2-(2-thiazolylazo)-4-methylphenol)cobalt(III)chloride
  bis(2',3,4',5,7-pentahydroxyflavone)europium(III)
  bis(2,3,4-trihydroxybenzaldoxyimato)copper(II)
  bis(2-((3,5-diphenyl-1H-pyrrol-2-ylidene-kappaN)amino)-3,5-diphenylpyrrol-1-ido-kappaN)palladium(II)
  bis(2,4,6-trichlorophenolato)diimidazolecopper(II) monohydrate
  bis(2,4,6-trimethylpyridinio)dichlorocuprate(II)
  bis(2,4-dimethylpyridinio)dichlorocuprate(II)
  bis(2-(5-chloro-2-pyridylazo)-5-diethylaminophenolato)cobalt
  bis(2,6-bis(1H-benzimidazol-2-yl-kappaN3)pyridinido-kappaN)zinc(II)
  bis(2,9-dimethyl-1,10-phenanthroline)copper(II) Has associated genes Has associated diseases
  bis(2,9-di-tert-butyl-1,10-phenanthroline)copper(I)
  bis(2-acetylpyridine-3-hexamethyleneiminylthiosemicarbazonato)palladium(II)
  bis(2'-amino-2'-deoxy-1'-glucosaminoethylamine)nickel(II)
  bis(2-amino-5-methylthiazole)tetrachlororuthenate(III)
  bis(2-aminoethyl)aminoethanol nickel(II) diperchlorate
  bis(2-aminopyridine-N)bis(benzoato-O)zinc(II)
  bis(2-benzimidazolyl)thioter copper complex
  Bis(2-benzyl-1H-benzimidazole-N(3))dichlorozinc(II)
  bis(2-carboxyphenyl)telluride
  bis(2-chloroethyl)ammonium hexachlorostannate
  bis(2-hydroxy-2-ethylbutanoato)oxochromate(V) Has associated genes Has associated diseases
  bis(2-(o-vanillinamino)-1-hydroxyethane)copper(II)
  bis((2-oxindol-3-ylimino)-2-(2-aminoethyl)pyridine-N,N')copper(II) Has associated genes Has associated diseases
  bis(2-phenanthroline)(dipyrido(3,2-a-2',3'-c)phenazine)cobalt(III)
  bis(2-phenylazopyridine)-ruthenium(II)
  bis(3-(5-chlorosalicylideneamino)propanolato-O,N-O')manganese(IV)
  bis(3,5-diisopropylsalicylato)bis(dimethylsulfoxido)zinc(II)
  (bis(3,5-dimethylpyrazol-1-yl)acetate)bis(tris(hydroxymethyl)phosphine)copper(I)
  (bis(3,5-dimethylpyrazol-1-yl-kappaN2)dithioacetato-kappaS)(triphenylphosphine-kappaP)copper(I)
  bis(3,5-di-t-butyl-1,2-benzoquinone 1-oximato)manganese(II)
  bis(3,5-di-tert-1,2-benzoquinone-2-monooximato)copper(II)
  Bis(3,6-bis(6-methyl-2pyridyl)pyridazine-kappa2N2,N3)chlorocopper(II) perchlorate
  bis(3-aminoflavone-kappa(2)N,O)bis(perchlorato-kappaO)copper(II)
  bis(3-carboxybenzoato-kappaO)bis(4-methyl-1H-imidazole-kappaN3)copper(II)
  (bis(3-ethoxy-2-hydroxybenzylidene)-N,N''-bis(2,2-dimethyl-3-aminopropyl)ethylenediamine)gallium(III) perchlorate
  bis(3-hydroxy-1(H)-2-methyl-4-pyridonato)oxidovanadium(IV)
  bis(3-mercapto-valinato)zinc hexahydrate
  bis(3-methylbenzoato-kappaN)bis(4-methyl-1H-imidazole-kappaN3)copper(II) monohydrate
  bis(4-((5-chloro-2-pyridyl)azo)-1,3-diaminobenzene)cobalt(II)
  bis(4,7-dimethyl-1,10-phenanthroline)sulfatooxovanadium(IV)
  bis(4-aminophenyl)telluride
  bis(4-chlorophenolato)(hydrotris(3,5-dimethyl-1-pyrazolyl)borato)oxomolybdenum (V)
  bis(4-hydroxy-2,6-dimethylphenyl)telluride
  bis(4-hydroxy-3-methoxybenzaldehyde thiosemicarbazonato-N(1),S)-nickel(II) tetraethanol solvate
  bis(4-hydroxyphenyl)telluride
  (bis(4-methoxy-5-sulfosalicylaldehyde)-4,5-dimethyl-2-phenylenediiminato)cobalt(II)
  bis((4-methoxybenzyl)cyclopentadienyl)titanium(IV) dichloride
  bis(5-dinitro-1,10-phenanthroline)sulfatooxovanadium(IV)
  (bis(5-ethoxy-2-hydroxybenzylidene)-N,N''-bis(2,2-dimethyl-3-aminopropyl)ethylenediamine)gallium(III) iodide
  bis(5-ethyl-5-phenylhydantoin)bispyridine Cu(II)
  bis(5-iodopicolinato)oxovanadium(IV)
  bis((5-nitrofuraldehyde)thiocarbonohydrazone)copper(II)
  (bis(5-sulfosalicylaldehyde)-2-phenylenediiminato)cobalt(II)
  (bis(5-sulfosalicylaldehyde)-4,5-dimethyl-2-phenylenediiminato)cobalt(II)
  bis(6,6'-dimethyl-2,2'-bipyridine)copper(II)
  bis(6-ethylpicolinato)oxovanadium(IV)
  bis(6-methylpicolinato)oxovanadium(IV)
  bis(8-hydroxy quinoline-5-solphonat)chloride aluminum(III)
  bis(8-quinolinolato) aluminum
  bis(8-quinolinolato)copper(II)
  bis(9,10-dihydro-9-oxo-10-acridineacetate)bis(imidazole)bis(methanol) nickel(II)
  bis(acesulfamato-kappaO(4))diaquabis(3-methylpyridine-kappaN)nickel(II)
  bis(acetato)bis(1-methyl-4,5-diphenylimidazole)copper(II)
  bis(acetato-kappa2O,O')diaquazinc(II)
  bis(acetato)tetrakis(imidazole)copper(II)
  bis(acetazolamido)bis(aquo)bis(nicotinamide)copper(II)
  bis(acetonitrile)bis(1-benzyl-(3-(2'-pyridyl))pyrazole)copper(I)
  bis(acetonitrile-kappaN)bis(hydridotris(3,5-dimethylpyrazol-1-yl-kappaN2)borato)di-mu3-sulfido-tetra-mu2-sulfido-di-mu2-thiocyanato-kappa2N-S-kappa2S-N-tetracopper(I)ditungsten(VI)
  bis(acetonitrile)tris((1,2-diphenylphosphino)ethane)dicopper(I)
  bis(acetylacetonate)oxovanadium(IV)
  bis(acetylacetonato-O,O')(2,4-hexadiene)ruthenium(II)
  bis(acetylacetonato)oxovanadium(IV)
  bis(acetylacetonato)zinc(II)
  bis(acetylacetone)copper(II)
  bis(acrylonitrile)(2,5,8,11-tetraaza-4,5,8,9-tetramethyldodecane)cobalt(II)
  bis(allixinato)oxovanadium(IV) Has associated genes Has associated diseases
  bis(allixinato)zinc
  bis(alpha-furancarboxylato)oxovanadium(IV) Has associated genes Has associated diseases
  (bis(aminoethyl)(methylaminoethyl)ammine)copper(I)
  bis(aminoguanidinium(1+)) hexafluorozirconate(IV)
  bis(azido-kappaN)bis(pyridine-2-carboxamide-kappa2N1,O2)nickel(II)
  bis(azido-kappaN)(sparteine-kappa(2)N,N')copper(II)
  bis(benzenethiolato)nitrosyl(tris(3,5-dimethyl-1-pyrazolyl)hydroborato)molybdenum(II)
  bis(benzylamino)silver(I) benzylcarbamate
  bis(benzyl N'-(indol-3-ylmethylene)hydrazinecarbodithioato)zinc(II)
  bis(bipyridine)(((10',15',20'-triphenyl)porphyrin(5'-p-phenoxy-5-ethanamido))-1,10-phenanthroline)ruthenium(II)
  bis(bipyridine)chloro(4-picolinic acid) osmium
  bis(bipyridyl)ruthenium(II)
  bis(bis(2,2'-bipyridine)ruthenium(II))(2,2'-4',4''-2'',2'''-quaterpyridine)
  bis(bis(bis(hydroxymethyl)phosphino)ethane)copper(I)
  bis(bis(tri-tert-butoxysilanethiolato)cadmium(II))
  bis((butyl 2-pyridyl ketone)thiocarbonohydrazone)copper(II)
  bis(chloro)-1,4-bis(dimethyl-3 or 4-pyridylsilyl)benzenepalladium(II)
  bis(cinchoninium tetrachlorocuprate(II)) trihydrate
  bis(cinoxacinate)copper(II)
  bis(citrate)cobaltate(II)
  bis(citric acid)lanthanum(III)
  bis(curcumino)oxovanadium
  biscyanotetraazacobalt
  bis(cyclo(histidylhistidine))copper(II) complex
  bis(cyclopentadienyl)acetonitrilechlorotitanium (IV) tetrachloroferrate (III)
  bis-cyclopentadienylditiocianatetitanium IV
  bis(cyclopentadienyl)magnesium
  bis(cyclopentadienyl)-N,N-diethyl dithiocarbamato vanadium(IV) tetrafluoro borate
  bis(cyclopentadienyl)rhenium
  bis(cyclopentadienyl)vanadium(IV)
  bis(cyclopentadienyl) zirconium
  bis(cysteinato(2-)-N,O,S)di-mu-oxodioxodimolybdate(2-)
  bis(cysteinato(2-)-N,O,S)dioxodi-mu-thioxodimolybdate(2-)
  bis(delta,delta-bis(1,10-phenanthroline)ruthenium(II))(mu-(1,7-bis(4-(4'-methyl-2,2'-bipyridyl)heptane)))
  bis(di(6-chloro-2-methylphenyl)carbazonate)nickel(II)
  bis(diaquabis(2,2-bipyridine N,N'-dioxide-kappa2O,O')cobalt(II))
  bis(dichloro(4-isopropylbenzaldehyde thiosemicarbazone)palladium(II))
  bis(diethyl-diselenocarbamato)copper(II)
  bis(diethylenetriamine-kappa3N)nickel(II) 5-amino-1,3,4-thiadiazole-2-sulfonamidate chloride monohydrate
  bis((dihydrogen pyrophosphato-kappa(2)O,O')(2,2':6',2''-terpyridine-kappa(3)N,N',N'')copper(II)) 4.5-hydrate
  bis(dihydroxyethyldithiocarbamate)Cu (II) complex
  bis(dimethyldithiocarbamate)Cu (II) complex
  bis(dimethylsulfoxide)bis(2-(3-(trifluoromethyl)phenyl)aminonicotinic acid)copper(II)
  bis-dimethylsulfoxido-cis-tetrachlorodi-mu-pivalatodirhenium(III)
  bis-dipicolylamine-Zinc(II)
  bis(dipyridophenazine)copper(II) complex
  bis(dithiolene)molybdenum (IV)
  bis(dithiolene)tungsten
  bis(dithiolene)tungsten(IV,VI) thiolate
  bis(eta(5)-cyclopentadienyl)zirconium(IV) dichloride
  bis(ethane-1,2-diamine)(beta-ethyl (S)-aspartato)cobalt(III) bis(perchlorate) monohydrate
  bis(ethanolamine-N,O)bis(saccharinato-N)copper(II)
  bis((ethyl 2-pyridyl ketone)thiocarbonohydrazone)copper(II)
  bis(ethylenediamine)(9,10-phenanthrenequinonediamine)rhodium(III)
  ((bis(ethylenediamine)copper(II)) bis(diiodocuprate(I)))
  bis(ethylenediaminium) bis(oxalohydroxamato(3-))nickelate(II)
  bis(ethylmaltolato)oxovanadium(IV)
  bis(glutathionato)cadmium
  bis(guanidine) zirconium bis(nitrilotriacetate) hydrate
  bis(hinokitiolato)copper(II)
  bis(hydrogen diphenylmethylphosphonato)magnesium
  (bis(hydroxyethyl)aminotris(hydroxymethyl)methane)oxochromate(V)
  bis(imidazole)(5,10,15,20-tetraphenylporphinato)iron(III) bis(1,2-dicyanoethylenedithiolato)cuprate(III) tetrakis(tetrahydrofuran)
  bis(imidazoline-2-thione)-copper(I)
  (bisindazole)tetrachlororuthenate(III)
  bis(isoorotato)diaquamagnesium(II) dihydrate
  bis(kojato)oxovanadium(IV)
  bis(kojic acid)manganese(II)
  bis(kojic acid)zinc(II)
  bis(maleonitriledithiolato) nickelate(III)
  bis(maltolato)zinc(II) Has associated genes Has associated diseases
  bis(micro2-(benzimidazol-2-yl)-2-ethanethiolato-N,S,S-chloro-palladium(II)) dimer
  bis(molybdopterin guanine dinucleotide)molybdenum
  bismoverol
  bis(mu-2-((1,5-diaza-1-cyclooctyl)-methyl)phenolato-N,N',O-O)bis-(chlorozinc(II))
  bis(mu-2-((2-(2-(2-chlorophenoxy)-1-oxidoethylidene)hydrazinylidene)methyl)phenolato)bis(pyridinecopper(II)) methanol
  bis(Mu-2-((2-carbamoylhydrazin-1-ylidene)methyl)phenolato)bis(chloridozinc(II))
  bis(mu-2-(5-((pyridin-4-ylmethyl)sulfanyl)-1,3,4-oxadiazol-2-yl)phenolato)bis((acetylacetonato))copper(II)
  bis(mu(3)-1,3,5-triamino-1,3,5-trideoxy-cis-inositolato(3-))tribismuth(III) trichloride hexahydrate
  bis(mu-6,6'-dimethoxy-2,2'-(propane-1,2-diylbis(iminomethylene))diphenolato)bis(aquacopper(II)) dihydrate
  bis(mu-benzoato-O:O')bis(3-(3-methoxysalicydeneamino)propanolato-O,N,O':O')dimanganese(III)
  bis(mu-carbonato)bis(mu-hydroxo)decakis(bipyridine)hexacopper
  bis(mu-N,N'-bis(quinolin-8-yl)pyridine-2,6-dicarboxamido)dizinc(II)
  bis((mu-N,N'-bis(salicylidene)-1,3-propanediaminatoaquanickel(II))(thiocyanato)(mu-thiocyanato)(mu-N,N'-dimethylformamide)lead(II))
  bis(mu-N,N'-di-p-tolylformamidinate) dirhodium
  bis-mu-oxodicopper(III)-phenolate complex
  bis(mu-phenyl 2-pyridyl ketone N4,N4-butane-1,4-diylthiosemicarbazonato)bis(chlorocopper(II))
  bis(mu-propionato)diaquatetrabromodirhenium (III)
  bis(mu-pyridine-2,6-carboxylato-O,N,O'-O)bis(triaquamanganese(II))pyridine-2,6-dicarboxylic acid
  bis(mu-pyridine-2,6-dicarboxylato)-kappa4O2,N,O6-O6'-kappa4O2-O2',N,O6-bis((azido-kappaN)(1,10-phenanthroline-kappa2N,N')bismuth(III))tetrahydrate
  bismuth-6-mercaptopurine
  bismuth dimercaptopropanol
  bismuth(III)-ciprofloxacin 1
  bismuth-norfloxacin
  bismuth silanolate
  bismuth subgallate
  bismuth subsalicylate Has associated diseases
  bismuth tripotassium dicitrate Has associated genes Has associated diseases
  bis(N-(2,5-di-tert-butylphenyl)salicylaldiminato)copper
  bis(N-(2,6-di-t-butyl-1-hydroxyphenyl)salicylideneminato)copper(II)
  bis(N-(2-aminoethyl) salicylaldiminato) chromium(III) chloride
  bis(N'-((2-hydroxyphenyl)methylidene)-2-(6-methoxynaphthalen-2-yl)propanehydrazide)dicopper(II)
  bis(N-(2-methylthiophenyl)3,5-di-tert-butyl-2-hydroxyaniline)copper(II)
  bis(naphthalocyaninato)cerium complex
  bis(N,N-diethyldithiocarbamate)Cu (II) complex
  bis-N,N-dimethylamino-2-(N-methylpyrrolyl)methyl cyclopentadienyl titanium (IV) Has associated genes Has associated diseases
  bis(N,N-dimethyl-isoleucinato)copper(II)
  bis(N-octylsalicylideniminato-N,O)copper(II)
  bis(O-acetyl)bipyridyl-bisaqua-dirhodium di(O-acetate)
  bis(O,O'-di-p-tolyldithiophosphato-S,S')(1,10-phenanthroline-N,N')nickel(II)
  bisperoxo(1,10-phenanthroline)oxovanadate(1-) Has associated genes Has associated diseases
  bis(phenanthrenequinonediimine)(4,4'-dimethyl-2,2'-dipyridine)rhodium(III)
  bis(phenanthrenequinonediimine)(4-(guanidylmethyl)-1,10-phenanthroline)rhodium(III)
  bis(phenanthrenequinonediimine)(bipyridyl)rhodium(III)
  bis(phenanthroline)(dipyridophenazine)ruthenium(II)
  bis(phenanthroline)(phenanthrenequinone diimine)rhodium(III)
  bis(phenylalaninamidato)Cu(II)
  bis(phenyl)dirhodium(III) caprolactamate
  bis(phthalocyaninato)lutetium(III)
  bis(picolyl)amine iridium
  bis(pyridinio)dichlorocuprate(II)
  bis(pyrrolidine-N-carbodithioato)oxovanadium(IV)
  bis(quercetinato)oxovanadium(IV) Has associated genes Has associated diseases
  bis(resorcylaldoximato)copper(II)
  bis(ruthenium-bipyridine)
  bis(ruthenium(chloroquine)dichloride)
  bis(saccharinato)bis(pyridine) zinc (II)
  bis(salicylaldiminato)zinc(II)
  bis(salicylaldoximato)copper(II)
  bis(S-benzyl-3-(4-n-octyloxybenzylidene)dithiocarbazato-kappa(2)N(3),S')palladium(II)
  bis(S-methylisothiosemicarbazido-N1, N4)bis(pyrazole-N2)-nickel(II) diiodide
  bis(sulfapyridine)nickel
  bis(terpyridine)cobalt(II) chloride
  bis(tert-butoxycarbonyl-histidyl-glycyl-histidine methyl ester)copper(II)
  bis(tetra-n-butylammonium)bis((madelato)oxo(peroxo)vanadate(V))
  bis(thioacetoxy)aurate
  bis(thioallixin-N-methyl)zinc(II)
  bis(thiophene-2-carbaldehyde thiosemicarbazone)nickel(II)
  bis(thiosemicarbazide-S,N)zinc(II) dinitrate
  bis(thiourea)cadmium(II)
  bis(thiourea)zinc(II) chloride
  bistriazolium-triazolepentachlororuthenate(III)
  bis(trichlorohexylphosphine)benzylideneruthenium
  bis(triethylsiloxy)-Ge(IV)-1,4,8,11,15,18,22,25-octabutoxyphthalocyanine
  bis(trihexylsiloxy) Si(IV)-tetradibenzobarreleno-octabutoxyphthalocyanine
  bis(trimethylsilyl)chromate
  bis(triphenylphosphine)gold(0) chlorohexakis(mu-hydroxo)hexakis(3,5-bis(trifluoromethyl)pyrazolate)hexacopper(II)
  bis(triphenylphosphine)palladium(II)
  bis(trispyrazolylborate)cobalt(II)
  bleomycin-vanadium(IV) complex
  blue rayon
  bomproamide
  boralumoxane
  bromo(2,9-(2,5,8-triaza-5-(N-anthracene-9-methylamino)ethyl)-(9)-1,10-phenanthrolinophane)zinc(II)
  bromochlorofluorogermane
  bromotricarbonyl(bis(1-methylthioimidazolyl)methane)rhenium(III)
  butyllithium
  butylmagnesium chloride
  C6(CH2-(N-benzimidazole-RuCl2(p-cymene)))6
  cadmium bleomycin
  cadmium(II)-cysteinate glycinate
  calcium glubionate
  calcium lidofenin
  camptothecin copper(II) complex
  Captostibone (g)
  carbonyl(tris(3-tert-butyl-5-methyl-1,2,4-triazolyl)borate)copper(I)
  carboxymethyl-dextran-A2-gadolinium-DOTA
  carboxymethyl hydroxyethyl starch-(Gd-DO3A)(35)
  carminomycin-iron complex
  Cascade Blue
  casiopeina II Has associated genes Has associated diseases
  casiopeina II-glycine Has associated genes Has associated diseases
  casiopeina IIIi
  casiopeine
  catena-pentachloridotricuprate
  catena-poly((acetatohexaaqua(mu4-2,6-bis(bis(carboxylatomethyl)aminomethyl)-4-methylphenolato)trizinc(II)) octahydrate)
  catena-poly((aqua(3-(2-pyridylsulfanyl)propionato N-oxide-kappaO1)copper(II))-mu-(3-(2-pyridylsulfanyl)propionato N-oxide-kappa3O3-O1,O1') dihydrate)
  catena-poly(((aquachloridocopper(II))-mu-N-(6-amino-3-methyl-5-nitroso-4-oxo-3,4-dihydropyrimidin-2-yl)glycinato)monohydrate)
  catena-poly(((aquacopper(II))-mu-3-(2-pyridylmethyleneamino)propanoato-kappa4N,N',O-O') perchlorate)
  catena-poly((bis(mu2-4-methylbenzoato-kappa(2)O-O')disilver(I)(Ag-Ag))-mu2-di-2-pyridylamine-kappa(2)N(2)-N(2'))
  catena-poly(cadmium(II)-bis(mu-6-methylpicolinato))
  catena-poly(((di-2-pyridylamine-kappaN(2))-(mu2-4-nitrobenzoato-kappa(2)O-O')disilver(I)(Ag-Ag))-mu3-4-nitrobenzoato-kappa(3)O-O'-O')
  catena-poly((diaqualithium(I))-mu-(9H-purine-2,6(1H,3H)-dionato-O(2)-N(&)))
  catena-poly((diisothiocyanatocadmium(II))-bis(mu-1,3-bis(1,2,4-triazol-1-ylmethyl)benzene-kappa(2)N(4)-N(4')))
  catena-poly((dinitratocadmium(II))bis(mu-bis(2-methyl-1H-imidazol-1-yl)methane-kappa(2)N(3)-N(N')))
  catena-poly(((dipyrido(3,2-a-2',3'-c)phenazine-2N,N')nickel(II))-2,6-dipicolinato-4O2,N,O6-O2')
  catena-Poly((((iminodiacetato-kappaO)silver(I))-mu3-2-aminopyrimidine-kappa3N1-N2-N3) monohydrate)
  catena-poly(potassium (copper(II)-mu-isothiocyanato-mu-N-salicylidene-beta-alaninato(2-)))
  (Cd(C(6)H(6)O(7))(H(2)O))(n)
  Cd(II)-2,6-bis(1-(4-amino-1,2,3,6-tetrahydro-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)imino)ethylpyridine
  cerium(IV)-rhodamine 6G
  cerium tetrasulfophthalocyanine
  cesium perfluorooctanoate
  (cesium subset(tricyanocyclopentadienylcobalt)4(pentamethylcyclopentadienylruthenium)3)
  cetyltrimethylammonium dichromate
  cFLFLFK-PEG-64Cu
  CGP 55398
  Ch 55G
  chloro(1,10-phenanthroline)(N-propylnorfloxacinato)copper(II)
  chloro(1,4,7,10-tetrakis(2'-pyridylmethyl)-1,4,7,10-tetraazacyclododecane)europium(III)
  chloro(2,2'-6',2''-terpyridine)(2,2'-bipyridine)ruthenium Has associated genes Has associated diseases
  chloro(2,3,7,8,12,13,17,18-octaethylporphinato)gallium(III)
  Chloro(2,9-dimethyl-1,10-phenanthroline-N,N')(isoquinoline-1-carboxylato-O,N)copper(II)
  chloro(2-acetylpyridine)(N(4)-methylthiosemicarbazonato)palladium(II)
  chloro(5,10,15,20-tetraphenylporphyrinato)manganese(III)
  chloroaluminum disulfonated phthalocyanine
  chloroaluminum phthalocyanine
  chloroaluminum tetrasulfophthalocyanine Has associated diseases
  chloro(eta(5)-cyclopentadienyl)dinitrosylchromine(III)
  chloro(eta(5)-cyclopentadienyl)-dinitrosylmolybdenum(III)
  chloro(eta6-4-cymene)bis(N-vinylimidazole)ruthenium(II)
  chloro(eta(6)-tetrahydroanthracene)(ethylenediamine)ruthenium(II)
  chloro(glycinato)(1,10-phenanthroline)copper(II)
  chloro(histamine)(1,10-phenanthroline)copper(II) chloride monohydrate
  chlorohydrido(tris(1-(diphenylphosphino)-3-methyl-1H-indol-2-yl)methane)rhodium(II)
  chloronitrosobis(diphenylphosphino)ruthenium(III)
  chloronitrosyl(1,4,8,12-tetraazacyclopentadecane)ruthenium(III)
  chloropentaamminerhodium(III)
  chlorotetrakis(ibuprofenato)diruthenium(II,III)
  chlorotris(diphenylphosphinobenzene-3-sulfonate)rhodium (I)
  chlorotris(triphenylphosphine)rhodium
  chromium-adenosine 5'-(beta,gamma-methylene)triphosphate complex
  chromium dinicocysteinate Has associated genes Has associated diseases
  chromium (D-Phenylalanine)3 Has associated genes Has associated diseases
  chromium hexacarbonyl
  chromium histidinate Has associated genes Has associated diseases
  chromium(III)bis(N-(2,6-diethylphenylcarbamoylmethyl)iminodiacetic acid)meglumine
  chromium maltolate
  chromium nicotinic acid complex Has associated genes Has associated diseases
  chromium triethylenediamine
  C.I. Direct Blue 199
  cinnamoylruthenocene
  C.I. Pigment Blue 15:4
  (ciprofloxacin)2(Bi2Cl10)
  cis-(4-aminothiophenol)bis(bipyridyl)(chloro)ruthenium(II) complex
  cis-(Cr(C2O2)(BaraNH2)OCO2)
  cis-(Cr(C2O4)(BaraNH2)(OH2)2)
  cis-dichlorobis(3,4,7,8-tetramethyl-1,10-phenanthroline)rhodium(III) chloride
  cis-dichloro(dipyrido(3,2a-2',3'c)phenazine)(1,10-phenanthroline)rhodium(III) chloride
  cis-methoxobis(2-methyl-3-oxo-4H-pyran-4-olato)oxovanadium(V)
  cis-(Ru(2,2'-bipyridine)2(3-aminopyridine)2)(PF6)2
  cis-(Ru(2,2'-bipyridine)2(5,6-bis(3-amidopyridine)-7-oxanorbornene))(PF6)2
  cis-(Ru(bpy)2(py)2)Cl2
  cis-(ruthenium(2)(mu-O2CCH3)2(CH3CN)6)
  clemizoledichlorocobalt(II)
  (Co(2-hydroxyhippuric acid)(imidazol)(3)).H(2)O (2)
  coamid
  cobaloxime
  cobalt(2,3,9,10-tetramethyl-1,4,8,11-tetraazaundecane-1,3,8,10-tetraen-11-ol-1-olate) cyanide(2)
  cobaltabisdicarbollide anion
  cobalt-desferal conjugate
  cobalt(II) (1,4-benzenedipyrazolate)
  cobalt(II) 2,9-dimethyl-1,10-phenanthroline
  cobalt(II)-4-((5-chloro-2-pyridyl)azo)-1,3-diaminobenzene
  cobalt (II) 4,7-dimethyl-1,10-phenanthroline
  cobalt(II) bis(2,2,6,6-tetramethylheptane-3,5-dionate)
  cobalt(III)-cycmmb
  cobalt(III)salicylaldoxime
  cobalt pentacyanonitrosylferrate
  cobalt-pentammine-ascorbate complex
  cobalt phthalocyanine
  cobalt-precorrin 5A
  cobalt-precorrin 5B
  cobalt tetracarboxyphthalocyanine
  cobalt-tetrammine-ascorbate complex
  cobalt tetrasulfophthalocyanine
  cobalt triethylene tetramine complex
  Co((en2)(NO2)2)NO3
  comethylenamine
  complex R
  contrast agent P792
View node Coordination Complexes Has associated genes Has associated diseases
  copper-1,10-phenanthroline Has associated genes Has associated diseases
  copper 1,2-oleyl-rac-glycero-3-(8-3,6-dioxy)octyl-1-amino-N,N-diacetic acid
  copper-1,4,8,11-tetraazacyclotetradecane-N,N',N'',N'''-tetraacetic acid-octreotate
  copper 1,4,8,11--tetraazacyclotetradecane-N,N',N'',N'''-tetraacetic acid-octreotide
  copper 1,4,8,11-tetraazacyclotetradecane-N,N',N'',N'''-tetraacetic acid tyrosyl(3)-octreotate
  copper(2)-(10-phenanthroline)2 tetrachloride
  (copper2II(3,5-ditertiarybutylsalicylate)4(ethanol)4)
  copper 4,11-bis(carboxymethyl)-1,4,8,11-tetraazabicyclo(6.6.2)hexadecane-ReCCMSH(Arg(11))
  copper-64-DOTA-biotin
  copper-64-DOTA-NR-LU-10
  copper(64)TETA-phenyalanyl-tyrosyl(3)-octreotate
  copper-67-2IT-BAT-Lym-1
  copper acetamidobenzyl-1,4,8,11-tetraazacyclotetradecane-N,N',N'',N'''-tetraacetic acid-serum albumin
  copper acetyl-histidyl-glycyl-glycyl-glycinamide
  copper acetyl-phenylalanyl-histidyl-glycyl-glycyl-glycyl-tryptophyl-glycyl-glutaminamide
  copper bis(histidinate)
  copper-bispidine
  copper-cysteinyl-glycyl-histidyl-lysine
  copper-desferal complex
  copper diethylamine oxyquinoline sulfonate
  copper-ethanolamine complex
  copper ethylenebis(dithiocarbamate)
  copper-glycyl-glycyl-histidine
  copper-hexadecafluoro-phthalocyanine
  copper histidine Has associated genes Has associated diseases
  copper(I) bis(2,9-dimethyl-1,10-phenanthroline)
  copper(II) 1,1,1,5,5,5-hexafluoroacetylacetonate
  copper(II)-1,4,8,11-tetraazacyclotetradecane-N,N',N'',N'''-tetraacetic acid
  copper(II)-2,10-di-n-butyl-3,9-dimethyl-1,4,8,11-tetraazaundeca-1,3,8,10-tetraen-1,11-dione dioxime
  copper(II) (2,3-butanedionebis(N(4)-methylthiosemicarbazone))
  copper(II)-2,6-diaminomethylpyridine
  copper(II)-2,6-pyridinedimethanol
  copper (II) 3-hydroxy-1-(4-phenylsulfonic acid)-3-phenyltriazene
  copper(II)5-methoxyisophthalate
  copper(II) acetylacetanoate
  copper(II) aminomethyltriazole
  copper(II) aspirinate
  copper(II)bis((3,5-dimethyl-1H-pyrazol-1-yl)methyl)amine
  copper(II) bis(phenylbutazone) complex
  copper(II)-cimetidine complex
  copper (II) diacetyl-di(N(4)-methylthiosemicarbazone) Has associated genes Has associated diseases
  copper(II)-doped dichlorobis(1,2-dimethylimidazole)zinc(II)
  copper (II) ethylglyoxal bis(N(4)-methylthiosemicarbazone)
  copper(II)furan-2,5-dicarboxylate
  copper(II) glycylglycyl-histidine-N-methylamide
  copper(II)-imidazolyl-semiquinonate
  copper(II)-methyl 2-(2-aminoethyl)aminoethylpyridine-6-carboxylhistidinate
  copper (II) N,N-dimethyl-L-phenylalanine
  copper(II)-N,N,N',N',N'',N''-hexakis(2-pyridyl)-1,3,5-tris(aminomethyl)benzene
  copper(II)-N-salicyloyl-N'-(2-furylthiocarbonyl)hydrazine
  copper (II) pyruvaldehyde bis(N(4)-dimethylthiosemicarbazone)
  copper(II) trifluoromethanesulfonate
  copper(II)-tyrosine complex
  copper(I)-(nicotinic acid)(2) chloride complex
  copper(I)-thiolate
  copper(I) tris(2-pyridylmethyl)amine
  copper(I)-tris(thiourea)
  copper methionate Has associated genes Has associated diseases
  copper (N-2-hydroxyacetophenone)glycinate Has associated genes Has associated diseases
  copper-neocuproine complex
  copper perbromophthalocyanine
  copper perchlorophthalocyanine
  copper phthalocyanine
  copper phthalocyanine tetrasulfonic acid
  copper phthalocyanine trisulfonic acid
  copper pyrithione
  copper pyruvaldehyde bis(N(4)-methylthiosemicarbazone) complex Has associated genes Has associated diseases
  copper salicylate complex
  copper-S-(methylthio)homocysteine complex
  copper tetra-aminophthalocyanine-Fe3O4
  copper tetrabenzo(b,f,j,n)-1,5,9,13-tetraazacyclohexadecine
  copper tetra-t-butylphthalocyanine
  copper-thiosemicarbazone complex Has associated genes Has associated diseases
  CORM-F10